C18H19NO4S — CID 59656534
4-[(2-methylbenzoyl)amino]-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid (PubChem CID 59656534) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[(2-methylbenzoyl)amino]-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid.
| Compound Name | 4-[(2-methylbenzoyl)amino]-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 59656534 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-[(2-methylbenzoyl)amino]-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)O)c2c1CCCC2 |
| InChI | InChI=1S/C18H19NO4S/c1-12-6-2-3-7-13(12)18(20)19-16-10-11-17(24(21,22)23)15-9-5-4-8-14(15)16/h2-3,6-7,10-11H,4-5,8-9H2,1H3,(H,19,20)(H,21,22,23) |
| InChIKey | HBNPRHVXYWDUAW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|