About 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid
7-amino-2,3-dihydro-1H-indene-4-sulfonic acid (PubChem CID 12683823) has the molecular formula C9H11NO3S
and a molecular weight of 213.26 g/mol. Its IUPAC name is 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid.
Molecular Properties
| Compound Name | 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid |
| PubChem CID | 12683823 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)c2c1CCC2 |
| InChI | InChI=1S/C9H11NO3S/c10-8-4-5-9(14(11,12)13)7-3-1-2-6(7)8/h4-5H,1-3,10H2,(H,11,12,13) |
| InChIKey | IUOAMLUXPZNOEV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid?
The IUPAC name of 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid (CID 12683823) is 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid.
What is the SMILES notation for 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid?
The canonical SMILES for 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid is Nc1ccc(S(=O)(=O)O)c2c1CCC2.
What is the InChIKey of 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid?
The InChIKey is IUOAMLUXPZNOEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3S/c10-8-4-5-9(14(11,12)13)7-3-1-2-6(7)8/h4-5H,1-3,10H2,(H,11,12,13).
What are the key properties of 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid?
7-amino-2,3-dihydro-1H-indene-4-sulfonic acid has a molecular weight of 213.26 g/mol, XLogP of 1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2,3-dihydro-1H-indene-4-sulfonic acid is sourced from PubChem (CID 12683823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).