C12H15NO — CID 53402832
1-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone (PubChem CID 53402832) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone.
| Compound Name | 1-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone |
|---|---|
| PubChem CID | 53402832 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone |
| SMILES | CC(=O)c1ccc(N)c2c1CCCC2 |
| InChI | InChI=1S/C12H15NO/c1-8(14)9-6-7-12(13)11-5-3-2-4-10(9)11/h6-7H,2-5,13H2,1H3 |
| InChIKey | HDNBHPRNBAZCOW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|