C16H14N2O10S2 — CID 3014950
1,5-dihydroxy-4,8-bis(methylamino)-9,10-dioxoanthracene-2,6-disulfonic acid (PubChem CID 3014950) has the molecular formula C16H14N2O10S2 and a molecular weight of 458.43 g/mol. Its IUPAC name is 1,5-dihydroxy-4,8-bis(methylamino)-9,10-dioxoanthracene-2,6-disulfonic acid.
| Compound Name | 1,5-dihydroxy-4,8-bis(methylamino)-9,10-dioxoanthracene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 3014950 |
| Molecular Formula | C16H14N2O10S2 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 1,5-dihydroxy-4,8-bis(methylamino)-9,10-dioxoanthracene-2,6-disulfonic acid |
| SMILES | CNc1cc(S(=O)(=O)O)c(O)c2c1C(=O)c1c(O)c(S(=O)(=O)O)cc(NC)c1C2=O |
| InChI | InChI=1S/C16H14N2O10S2/c1-17-5-3-7(29(23,24)25)13(19)11-9(5)15(21)12-10(16(11)22)6(18-2)4-8(14(12)20)30(26,27)28/h3-4,17-20H,1-2H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | UIWOLZNQTVADJW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|