C14H5N2NaO14S2 — CID 170846853
sodium 8-hydroxy-4,5-dinitro-9,10-dioxo-2,7-disulfoanthracen-1-olate (PubChem CID 170846853) has the molecular formula C14H5N2NaO14S2 and a molecular weight of 512.32 g/mol. Its IUPAC name is sodium 8-hydroxy-4,5-dinitro-9,10-dioxo-2,7-disulfoanthracen-1-olate.
| Compound Name | sodium 8-hydroxy-4,5-dinitro-9,10-dioxo-2,7-disulfoanthracen-1-olate |
|---|---|
| PubChem CID | 170846853 |
| Molecular Formula | C14H5N2NaO14S2 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 511.91 |
| IUPAC Name | sodium 8-hydroxy-4,5-dinitro-9,10-dioxo-2,7-disulfoanthracen-1-olate |
| SMILES | O=C1c2c([N+](=O)[O-])cc(S(=O)(=O)O)c([O-])c2C(=O)c2c(O)c(S(=O)(=O)O)cc([N+](=O)[O-])c21.[Na+] |
| InChI | InChI=1S/C14H6N2O14S2.Na/c17-11-5(31(25,26)27)1-3(15(21)22)7-9(11)14(20)10-8(13(7)19)4(16(23)24)2-6(12(10)18)32(28,29)30;/h1-2,17-18H,(H,25,26,27)(H,28,29,30);/q;+1/p-1 |
| InChIKey | YLXMZXOFSXABAF-UHFFFAOYSA-M |
| XLogP | -3.44 |
| TPSA | 272.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|