C14H8N2O14S2-2 — CID 135856125
4-(dihydroxyamino)-9,10-dihydroxy-8-nitro-2,6-disulfoanthracene-1,5-diolate (PubChem CID 135856125) has the molecular formula C14H8N2O14S2-2 and a molecular weight of 492.35 g/mol. Its IUPAC name is 4-(dihydroxyamino)-9,10-dihydroxy-8-nitro-2,6-disulfoanthracene-1,5-diolate.
| Compound Name | 4-(dihydroxyamino)-9,10-dihydroxy-8-nitro-2,6-disulfoanthracene-1,5-diolate |
|---|---|
| PubChem CID | 135856125 |
| Molecular Formula | C14H8N2O14S2-2 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | 4-(dihydroxyamino)-9,10-dihydroxy-8-nitro-2,6-disulfoanthracene-1,5-diolate |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)O)c([O-])c2c(O)c3c(N(O)O)cc(S(=O)(=O)O)c([O-])c3c(O)c12 |
| InChI | InChI=1S/C14H10N2O14S2/c17-11-5(31(25,26)27)1-3(15(21)22)7-9(11)14(20)8-4(16(23)24)2-6(32(28,29)30)12(18)10(8)13(7)19/h1-2,17-22H,(H,25,26,27)(H,28,29,30)/p-2 |
| InChIKey | ZRVWXMFOYYXZQZ-UHFFFAOYSA-L |
| XLogP | -0.46 |
| TPSA | 282.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|