C10H15N3O5S — CID 23172113
2,4-bis(dimethylamino)-5-nitrobenzenesulfonic acid (PubChem CID 23172113) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 2,4-bis(dimethylamino)-5-nitrobenzenesulfonic acid.
| Compound Name | 2,4-bis(dimethylamino)-5-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 23172113 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2,4-bis(dimethylamino)-5-nitrobenzenesulfonic acid |
| SMILES | CN(C)c1cc(N(C)C)c(S(=O)(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O5S/c1-11(2)7-5-9(12(3)4)10(19(16,17)18)6-8(7)13(14)15/h5-6H,1-4H3,(H,16,17,18) |
| InChIKey | LZLUTUYRHQEUIP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|