C14H4N2O14S2-2 — CID 3724999
1,8-dihydroxy-4,5-dinitro-9,10-dioxoanthracene-2,7-disulfonate (PubChem CID 3724999) has the molecular formula C14H4N2O14S2-2 and a molecular weight of 488.32 g/mol. Its IUPAC name is 1,8-dihydroxy-4,5-dinitro-9,10-dioxoanthracene-2,7-disulfonate.
| Compound Name | 1,8-dihydroxy-4,5-dinitro-9,10-dioxoanthracene-2,7-disulfonate |
|---|---|
| PubChem CID | 3724999 |
| Molecular Formula | C14H4N2O14S2-2 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 487.91 |
| IUPAC Name | 1,8-dihydroxy-4,5-dinitro-9,10-dioxoanthracene-2,7-disulfonate |
| SMILES | O=C1c2c([N+](=O)[O-])cc(S(=O)(=O)[O-])c(O)c2C(=O)c2c(O)c(S(=O)(=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C14H6N2O14S2/c17-11-5(31(25,26)27)1-3(15(21)22)7-9(11)14(20)10-8(13(7)19)4(16(23)24)2-6(12(10)18)32(28,29)30/h1-2,17-18H,(H,25,26,27)(H,28,29,30)/p-2 |
| InChIKey | JJRLFGKLVBSIQX-UHFFFAOYSA-L |
| XLogP | -0.50 |
| TPSA | 275.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|