C14H7NO7 — CID 3116509
1,4,5-trihydroxy-8-nitroanthracene-9,10-dione (PubChem CID 3116509) has the molecular formula C14H7NO7 and a molecular weight of 301.21 g/mol. Its IUPAC name is 1,4,5-trihydroxy-8-nitroanthracene-9,10-dione.
| Compound Name | 1,4,5-trihydroxy-8-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 3116509 |
| Molecular Formula | C14H7NO7 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1,4,5-trihydroxy-8-nitroanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c([N+](=O)[O-])ccc(O)c21 |
| InChI | InChI=1S/C14H7NO7/c16-6-2-1-5(15(21)22)9-10(6)14(20)12-8(18)4-3-7(17)11(12)13(9)19/h1-4,16-18H |
| InChIKey | PPXPCKBOIVQWQT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|