C14H5N3O10 — CID 5484961
1,8-dihydroxy-2,4,5-trinitroanthracene-9,10-dione (PubChem CID 5484961) has the molecular formula C14H5N3O10 and a molecular weight of 375.21 g/mol. Its IUPAC name is 1,8-dihydroxy-2,4,5-trinitroanthracene-9,10-dione.
| Compound Name | 1,8-dihydroxy-2,4,5-trinitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 5484961 |
| Molecular Formula | C14H5N3O10 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 1,8-dihydroxy-2,4,5-trinitroanthracene-9,10-dione |
| SMILES | O=C1c2c([N+](=O)[O-])ccc(O)c2C(=O)c2c(O)c([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C14H5N3O10/c18-7-2-1-4(15(22)23)8-10(7)14(21)11-9(13(8)20)5(16(24)25)3-6(12(11)19)17(26)27/h1-3,18-19H |
| InChIKey | ZBTXWMXJWUFKMS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|