C18H9NO6S — CID 154412233
1,8-dihydroxy-4-nitro-5-thiophen-2-ylanthracene-9,10-dione (PubChem CID 154412233) has the molecular formula C18H9NO6S and a molecular weight of 367.34 g/mol. Its IUPAC name is 1,8-dihydroxy-4-nitro-5-thiophen-2-ylanthracene-9,10-dione.
| Compound Name | 1,8-dihydroxy-4-nitro-5-thiophen-2-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 154412233 |
| Molecular Formula | C18H9NO6S |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 1,8-dihydroxy-4-nitro-5-thiophen-2-ylanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(-c3cccs3)c2C(=O)c2c([N+](=O)[O-])ccc(O)c21 |
| InChI | InChI=1S/C18H9NO6S/c20-10-5-3-8(12-2-1-7-26-12)13-15(10)18(23)16-11(21)6-4-9(19(24)25)14(16)17(13)22/h1-7,20-21H |
| InChIKey | IZCJMNQHJUQSBZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|