C21H13N3O7 — CID 163633258
3-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]benzamide (PubChem CID 163633258) has the molecular formula C21H13N3O7 and a molecular weight of 419.35 g/mol. Its IUPAC name is 3-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]benzamide.
| Compound Name | 3-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]benzamide |
|---|---|
| PubChem CID | 163633258 |
| Molecular Formula | C21H13N3O7 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-[(4,5-dihydroxy-8-nitro-9,10-dioxoanthracen-1-yl)amino]benzamide |
| SMILES | NC(=O)c1cccc(Nc2ccc(O)c3c2C(=O)c2c([N+](=O)[O-])ccc(O)c2C3=O)c1 |
| InChI | InChI=1S/C21H13N3O7/c22-21(29)9-2-1-3-10(8-9)23-11-4-6-13(25)17-15(11)19(27)16-12(24(30)31)5-7-14(26)18(16)20(17)28/h1-8,23,25-26H,(H2,22,29) |
| InChIKey | HXXWPOMWWBSCEI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|