About (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium
(5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium (PubChem CID 88960686) has the molecular formula C22H17N2O4+
and a molecular weight of 373.39 g/mol. Its IUPAC name is (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium.
Molecular Properties
| Compound Name | (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium |
| PubChem CID | 88960686 |
| Molecular Formula | C22H17N2O4+ |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium |
| SMILES | C=C1c2c(O)ccc(Nc3ccccc3)c2C(=O)c2c(O)ccc([N+](C)=O)c21 |
| InChI | InChI=1S/C22H16N2O4/c1-12-18-15(24(2)28)9-11-17(26)21(18)22(27)20-14(8-10-16(25)19(12)20)23-13-6-4-3-5-7-13/h3-11H,1H2,2H3,(H2-,23,25,26,27,28)/p+1 |
| InChIKey | AYSHHILCYSKDMU-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium?
The IUPAC name of (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium (CID 88960686) is (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium.
What is the SMILES notation for (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium?
The canonical SMILES for (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium is C=C1c2c(O)ccc(Nc3ccccc3)c2C(=O)c2c(O)ccc([N+](C)=O)c21.
What is the InChIKey of (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium?
The InChIKey is AYSHHILCYSKDMU-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H16N2O4/c1-12-18-15(24(2)28)9-11-17(26)21(18)22(27)20-14(8-10-16(25)19(12)20)23-13-6-4-3-5-7-13/h3-11H,1H2,2H3,(H2-,23,25,26,27,28)/p+1.
What are the key properties of (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium?
(5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium has a molecular weight of 373.39 g/mol, XLogP of 4.49, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-anilino-4,8-dihydroxy-9-methylidene-10-oxoanthracen-1-yl)-methyl-oxoazanium is sourced from PubChem (CID 88960686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).