C26H25NO2 — CID 89188292
1-hydroxy-4,5-dimethyl-10-methylidene-8-(4-propan-2-ylanilino)anthracen-9-one (PubChem CID 89188292) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-hydroxy-4,5-dimethyl-10-methylidene-8-(4-propan-2-ylanilino)anthracen-9-one.
| Compound Name | 1-hydroxy-4,5-dimethyl-10-methylidene-8-(4-propan-2-ylanilino)anthracen-9-one |
|---|---|
| PubChem CID | 89188292 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-hydroxy-4,5-dimethyl-10-methylidene-8-(4-propan-2-ylanilino)anthracen-9-one |
| SMILES | C=C1c2c(C)ccc(O)c2C(=O)c2c(Nc3ccc(C(C)C)cc3)ccc(C)c21 |
| InChI | InChI=1S/C26H25NO2/c1-14(2)18-8-10-19(11-9-18)27-20-12-6-15(3)22-17(5)23-16(4)7-13-21(28)25(23)26(29)24(20)22/h6-14,27-28H,5H2,1-4H3 |
| InChIKey | NGNHUOXOQIYZLD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|