3-amino-2-hydroxy-4-nitrobenzenesulfonic acid

C6H6N2O6S — CID 54315805

IUPAC3-amino-2-hydroxy-4-nitrobenzenesulfonic acid
SMILESNc1c([N+](=O)[O-])ccc(S(=O)(=O)O)c1O
InChIInChI=1S/C6H6N2O6S/c7-5-3(8(10)11)1-2-4(6(5)9)15(12,13)14/h1-2,9H,7H2,(H,12,13,14)
InChIKeySOBNIVRBEVDUMB-UHFFFAOYSA-N
MW234.19 g/mol
LogP0.13
Rot. Bonds2

About 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid

3-amino-2-hydroxy-4-nitrobenzenesulfonic acid (PubChem CID 54315805) has the molecular formula C6H6N2O6S and a molecular weight of 234.19 g/mol. Its IUPAC name is 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid.

Molecular Properties

Compound Name3-amino-2-hydroxy-4-nitrobenzenesulfonic acid
PubChem CID54315805
Molecular FormulaC6H6N2O6S
Molecular Weight234.19 g/mol
Exact Mass233.99
IUPAC Name3-amino-2-hydroxy-4-nitrobenzenesulfonic acid
SMILESNc1c([N+](=O)[O-])ccc(S(=O)(=O)O)c1O
InChIInChI=1S/C6H6N2O6S/c7-5-3(8(10)11)1-2-4(6(5)9)15(12,13)14/h1-2,9H,7H2,(H,12,13,14)
InChIKeySOBNIVRBEVDUMB-UHFFFAOYSA-N
XLogP0.13
TPSA143.76 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.19
LogP ≤ 50.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-amino-2-methoxy-4-nitrobenzenesulfonic acid
CID 170850512
CID 173354294
CID 173354294
3-fluoro-2,4-dinitrobenzenesulfonic acid
CID 21151034
4-amino-2,3-dinitrobenzenesulfonic acid
CID 54502813
2-amino-6-(2-hydroxyethyl)-3-nitrophenol
CID 67031897
4-amino-3,5-dinitrobenzenesulfonic acid
CID 3562834
4-hydroxy-3-nitronaphthalene-1-sulfonic acid
CID 3018258
2-amino-3-nitro-5-(trifluoromethyl)benzenesulfonic acid
CID 154163490
6-amino-8-nitronaphthalene-2-sulfonic acid
CID 118985201
3,4-dinitrobenzenesulfonic acid
CID 21271067
sodium 5-amino-2-hydroxy-3-nitrobenzenesulfonate
CID 101305465
2-amino-4-fluoro-5-nitrobenzenesulfonic acid
CID 22766368

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid?
The IUPAC name of 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid (CID 54315805) is 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid.
What is the SMILES notation for 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid?
The canonical SMILES for 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid is Nc1c([N+](=O)[O-])ccc(S(=O)(=O)O)c1O.
What is the InChIKey of 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid?
The InChIKey is SOBNIVRBEVDUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O6S/c7-5-3(8(10)11)1-2-4(6(5)9)15(12,13)14/h1-2,9H,7H2,(H,12,13,14).
What are the key properties of 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid?
3-amino-2-hydroxy-4-nitrobenzenesulfonic acid has a molecular weight of 234.19 g/mol, XLogP of 0.13, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-hydroxy-4-nitrobenzenesulfonic acid is sourced from PubChem (CID 54315805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).