C7H5F3N2O5S — CID 154163490
2-amino-3-nitro-5-(trifluoromethyl)benzenesulfonic acid (PubChem CID 154163490) has the molecular formula C7H5F3N2O5S and a molecular weight of 286.19 g/mol. Its IUPAC name is 2-amino-3-nitro-5-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 2-amino-3-nitro-5-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 154163490 |
| Molecular Formula | C7H5F3N2O5S |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 2-amino-3-nitro-5-(trifluoromethyl)benzenesulfonic acid |
| SMILES | Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C7H5F3N2O5S/c8-7(9,10)3-1-4(12(13)14)6(11)5(2-3)18(15,16)17/h1-2H,11H2,(H,15,16,17) |
| InChIKey | BNSSDUYEJXOYEE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|