C10H5F8N3O3 — CID 13020312
N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 13020312) has the molecular formula C10H5F8N3O3 and a molecular weight of 367.15 g/mol. Its IUPAC name is N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 13020312 |
| Molecular Formula | C10H5F8N3O3 |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-[2-amino-3-nitro-5-(trifluoromethyl)phenyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | Nc1c(NC(=O)C(F)(F)C(F)(F)F)cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H5F8N3O3/c11-8(12,10(16,17)18)7(22)20-4-1-3(9(13,14)15)2-5(6(4)19)21(23)24/h1-2H,19H2,(H,20,22) |
| InChIKey | OQUUABHMMRSLHX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|