C14H8F6N4O3 — CID 141373198
N-(6-amino-5-nitro-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 141373198) has the molecular formula C14H8F6N4O3 and a molecular weight of 394.23 g/mol. Its IUPAC name is N-(6-amino-5-nitro-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(6-amino-5-nitro-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141373198 |
| Molecular Formula | C14H8F6N4O3 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-(6-amino-5-nitro-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Nc1nc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8F6N4O3/c15-13(16,17)7-3-6(4-8(5-7)14(18,19)20)12(25)23-10-2-1-9(24(26)27)11(21)22-10/h1-5H,(H3,21,22,23,25) |
| InChIKey | IDSKXHQHQLMKGU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|