C12H10N4O4 — CID 79826488
4-[(6-amino-5-nitro-2-pyridinyl)amino]benzoic acid (PubChem CID 79826488) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-[(6-amino-5-nitro-2-pyridinyl)amino]benzoic acid.
| Compound Name | 4-[(6-amino-5-nitro-2-pyridinyl)amino]benzoic acid |
|---|---|
| PubChem CID | 79826488 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4-[(6-amino-5-nitro-2-pyridinyl)amino]benzoic acid |
| SMILES | Nc1nc(Nc2ccc(C(=O)O)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N4O4/c13-11-9(16(19)20)5-6-10(15-11)14-8-3-1-7(2-4-8)12(17)18/h1-6H,(H,17,18)(H3,13,14,15) |
| InChIKey | CFJXFHHYHLWILV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|