C20H15ClF3N5O5 — CID 141413628
N-(6-amino-5-nitro-2-pyridinyl)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide (PubChem CID 141413628) has the molecular formula C20H15ClF3N5O5 and a molecular weight of 497.82 g/mol. Its IUPAC name is N-(6-amino-5-nitro-2-pyridinyl)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide.
| Compound Name | N-(6-amino-5-nitro-2-pyridinyl)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide |
|---|---|
| PubChem CID | 141413628 |
| Molecular Formula | C20H15ClF3N5O5 |
| Molecular Weight | 497.82 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | N-(6-amino-5-nitro-2-pyridinyl)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide |
| SMILES | CC(Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C20H15ClF3N5O5/c1-10(18(30)28-16-7-6-15(29(31)32)17(25)27-16)33-12-2-4-13(5-3-12)34-19-14(21)8-11(9-26-19)20(22,23)24/h2-10H,1H3,(H3,25,27,28,30) |
| InChIKey | JQTPYCSAHOFYAL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|