C12H10F3N5O3S — CID 141373176
N-(6-amino-5-nitro-2-pyridinyl)-2-ethyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 141373176) has the molecular formula C12H10F3N5O3S and a molecular weight of 361.31 g/mol. Its IUPAC name is N-(6-amino-5-nitro-2-pyridinyl)-2-ethyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(6-amino-5-nitro-2-pyridinyl)-2-ethyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 141373176 |
| Molecular Formula | C12H10F3N5O3S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-(6-amino-5-nitro-2-pyridinyl)-2-ethyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(C(F)(F)F)c(C(=O)Nc2ccc([N+](=O)[O-])c(N)n2)s1 |
| InChI | InChI=1S/C12H10F3N5O3S/c1-2-7-19-9(12(13,14)15)8(24-7)11(21)18-6-4-3-5(20(22)23)10(16)17-6/h3-4H,2H2,1H3,(H3,16,17,18,21) |
| InChIKey | LZVCUJAOYWHODM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|