C12H9F3N4O4S — CID 141373213
N-(6-methoxy-3-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 141373213) has the molecular formula C12H9F3N4O4S and a molecular weight of 362.29 g/mol. Its IUPAC name is N-(6-methoxy-3-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(6-methoxy-3-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 141373213 |
| Molecular Formula | C12H9F3N4O4S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-(6-methoxy-3-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])c(NC(=O)c2sc(C)nc2C(F)(F)F)n1 |
| InChI | InChI=1S/C12H9F3N4O4S/c1-5-16-9(12(13,14)15)8(24-5)11(20)18-10-6(19(21)22)3-4-7(17-10)23-2/h3-4H,1-2H3,(H,17,18,20) |
| InChIKey | MMEAHKPQQDZTCJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|