C17H17F3N4O3S — CID 141373233
N-(6-cyclohexyl-5-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 141373233) has the molecular formula C17H17F3N4O3S and a molecular weight of 414.41 g/mol. Its IUPAC name is N-(6-cyclohexyl-5-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(6-cyclohexyl-5-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 141373233 |
| Molecular Formula | C17H17F3N4O3S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-(6-cyclohexyl-5-nitro-2-pyridinyl)-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)c(C(=O)Nc2ccc([N+](=O)[O-])c(C3CCCCC3)n2)s1 |
| InChI | InChI=1S/C17H17F3N4O3S/c1-9-21-15(17(18,19)20)14(28-9)16(25)23-12-8-7-11(24(26)27)13(22-12)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3,(H,22,23,25) |
| InChIKey | WGUKPQLZASGGLQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|