C14H14F3N5O3S — CID 86281251
N-(6-amino-5-nitro-2-pyridinyl)-2-butyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 86281251) has the molecular formula C14H14F3N5O3S and a molecular weight of 389.36 g/mol. Its IUPAC name is N-(6-amino-5-nitro-2-pyridinyl)-2-butyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(6-amino-5-nitro-2-pyridinyl)-2-butyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 86281251 |
| Molecular Formula | C14H14F3N5O3S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-(6-amino-5-nitro-2-pyridinyl)-2-butyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCCc1nc(C(F)(F)F)c(C(=O)Nc2ccc([N+](=O)[O-])c(N)n2)s1 |
| InChI | InChI=1S/C14H14F3N5O3S/c1-2-3-4-9-21-11(14(15,16)17)10(26-9)13(23)20-8-6-5-7(22(24)25)12(18)19-8/h5-6H,2-4H2,1H3,(H3,18,19,20,23) |
| InChIKey | LYBDBZFCSYYZKG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|