C9H4Cl2F4N4O4 — CID 22617187
2,2-dichloro-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-fluoroethanimidamide (PubChem CID 22617187) has the molecular formula C9H4Cl2F4N4O4 and a molecular weight of 379.05 g/mol. Its IUPAC name is 2,2-dichloro-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-fluoroethanimidamide.
| Compound Name | 2,2-dichloro-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-fluoroethanimidamide |
|---|---|
| PubChem CID | 22617187 |
| Molecular Formula | C9H4Cl2F4N4O4 |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 2,2-dichloro-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-fluoroethanimidamide |
| SMILES | N/C(=N/c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])C(F)(Cl)Cl |
| InChI | InChI=1S/C9H4Cl2F4N4O4/c10-8(11,12)7(16)17-6-4(18(20)21)1-3(9(13,14)15)2-5(6)19(22)23/h1-2H,(H2,16,17) |
| InChIKey | MCSBXDPDWAZDJD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|