C10H2BrClF7N3O4 — CID 139900916
3-bromo-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidoyl chloride (PubChem CID 139900916) has the molecular formula C10H2BrClF7N3O4 and a molecular weight of 476.49 g/mol. Its IUPAC name is 3-bromo-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidoyl chloride.
| Compound Name | 3-bromo-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidoyl chloride |
|---|---|
| PubChem CID | 139900916 |
| Molecular Formula | C10H2BrClF7N3O4 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 474.88 |
| IUPAC Name | 3-bromo-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidoyl chloride |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1/N=C(\Cl)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C10H2BrClF7N3O4/c11-10(18,19)8(13,14)7(12)20-6-4(21(23)24)1-3(9(15,16)17)2-5(6)22(25)26/h1-2H/b20-7- |
| InChIKey | ZZHSLIRQTJDGAV-SCDVKCJHSA-N |
| XLogP | 5.41 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|