C10H5F7N4O4 — CID 15906760
N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidamide (PubChem CID 15906760) has the molecular formula C10H5F7N4O4 and a molecular weight of 378.16 g/mol. Its IUPAC name is N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidamide.
| Compound Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidamide |
|---|---|
| PubChem CID | 15906760 |
| Molecular Formula | C10H5F7N4O4 |
| Molecular Weight | 378.16 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2,3,3-tetrafluoropropanimidamide |
| SMILES | N/C(=N\c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C10H5F7N4O4/c11-7(12)9(13,14)8(18)19-6-4(20(22)23)1-3(10(15,16)17)2-5(6)21(24)25/h1-2,7H,(H2,18,19) |
| InChIKey | KZZYFUDJBFGSOA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|