C10H7F5N4O4S — CID 22617146
N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2-difluoro-2-methylsulfanylethanimidamide (PubChem CID 22617146) has the molecular formula C10H7F5N4O4S and a molecular weight of 374.25 g/mol. Its IUPAC name is N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2-difluoro-2-methylsulfanylethanimidamide.
| Compound Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2-difluoro-2-methylsulfanylethanimidamide |
|---|---|
| PubChem CID | 22617146 |
| Molecular Formula | C10H7F5N4O4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,2-difluoro-2-methylsulfanylethanimidamide |
| SMILES | CSC(F)(F)/C(N)=N\c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F5N4O4S/c1-24-10(14,15)8(16)17-7-5(18(20)21)2-4(9(11,12)13)3-6(7)19(22)23/h2-3H,1H3,(H2,16,17) |
| InChIKey | DOKXOBBAASOGEF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|