C10H4BrF7N4O4 — CID 22617167
2-bromo-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3,3,3-tetrafluoropropanimidamide (PubChem CID 22617167) has the molecular formula C10H4BrF7N4O4 and a molecular weight of 457.06 g/mol. Its IUPAC name is 2-bromo-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3,3,3-tetrafluoropropanimidamide.
| Compound Name | 2-bromo-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3,3,3-tetrafluoropropanimidamide |
|---|---|
| PubChem CID | 22617167 |
| Molecular Formula | C10H4BrF7N4O4 |
| Molecular Weight | 457.06 g/mol |
| Exact Mass | 455.93 |
| IUPAC Name | 2-bromo-N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3,3,3-tetrafluoropropanimidamide |
| SMILES | N/C(=N\c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])C(F)(Br)C(F)(F)F |
| InChI | InChI=1S/C10H4BrF7N4O4/c11-8(12,10(16,17)18)7(19)20-6-4(21(23)24)1-3(9(13,14)15)2-5(6)22(25)26/h1-2H,(H2,19,20) |
| InChIKey | LXTFAVPWUXSGEU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.06 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|