C13H10F3N3O4 — CID 12033743
N-[2,6-dinitro-4-(trifluoromethyl)phenyl]cyclohex-2-en-1-imine (PubChem CID 12033743) has the molecular formula C13H10F3N3O4 and a molecular weight of 329.23 g/mol. Its IUPAC name is N-[2,6-dinitro-4-(trifluoromethyl)phenyl]cyclohex-2-en-1-imine.
| Compound Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 12033743 |
| Molecular Formula | C13H10F3N3O4 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]cyclohex-2-en-1-imine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N=C1C=CCCC1 |
| InChI | InChI=1S/C13H10F3N3O4/c14-13(15,16)8-6-10(18(20)21)12(11(7-8)19(22)23)17-9-4-2-1-3-5-9/h2,4,6-7H,1,3,5H2 |
| InChIKey | IVWOHYGOMMASCI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|