C11H10Cl2F3N3O2 — CID 150256780
2,2-dichloro-N'-ethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 150256780) has the molecular formula C11H10Cl2F3N3O2 and a molecular weight of 344.12 g/mol. Its IUPAC name is 2,2-dichloro-N'-ethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2,2-dichloro-N'-ethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 150256780 |
| Molecular Formula | C11H10Cl2F3N3O2 |
| Molecular Weight | 344.12 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2,2-dichloro-N'-ethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | CC/N=C(\N)C(Cl)(Cl)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10Cl2F3N3O2/c1-2-18-9(17)10(12,13)7-4-3-6(11(14,15)16)5-8(7)19(20)21/h3-5H,2H2,1H3,(H2,17,18) |
| InChIKey | GASMBXXXCNQFLF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.12 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|