C15H10Br2N2O4 — CID 14007994
4-amino-2,7-dibromo-1,8-dihydroxy-5-(methylamino)anthracene-9,10-dione (PubChem CID 14007994) has the molecular formula C15H10Br2N2O4 and a molecular weight of 442.06 g/mol. Its IUPAC name is 4-amino-2,7-dibromo-1,8-dihydroxy-5-(methylamino)anthracene-9,10-dione.
| Compound Name | 4-amino-2,7-dibromo-1,8-dihydroxy-5-(methylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 14007994 |
| Molecular Formula | C15H10Br2N2O4 |
| Molecular Weight | 442.06 g/mol |
| Exact Mass | 439.90 |
| IUPAC Name | 4-amino-2,7-dibromo-1,8-dihydroxy-5-(methylamino)anthracene-9,10-dione |
| SMILES | CNc1cc(Br)c(O)c2c1C(=O)c1c(N)cc(Br)c(O)c1C2=O |
| InChI | InChI=1S/C15H10Br2N2O4/c1-19-7-3-5(17)13(21)11-9(7)14(22)8-6(18)2-4(16)12(20)10(8)15(11)23/h2-3,19-21H,18H2,1H3 |
| InChIKey | SKKLXZJRYFJOHG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.06 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|