C18H17BrN4O2 — CID 135984924
4,8-diamino-6-bromo-2-[3-(dimethylamino)phenyl]imino-5-hydroxynaphthalen-1-one (PubChem CID 135984924) has the molecular formula C18H17BrN4O2 and a molecular weight of 401.26 g/mol. Its IUPAC name is 4,8-diamino-6-bromo-2-[3-(dimethylamino)phenyl]imino-5-hydroxynaphthalen-1-one.
| Compound Name | 4,8-diamino-6-bromo-2-[3-(dimethylamino)phenyl]imino-5-hydroxynaphthalen-1-one |
|---|---|
| PubChem CID | 135984924 |
| Molecular Formula | C18H17BrN4O2 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 4,8-diamino-6-bromo-2-[3-(dimethylamino)phenyl]imino-5-hydroxynaphthalen-1-one |
| SMILES | CN(C)c1cccc(/N=C2\C=C(N)c3c(O)c(Br)cc(N)c3C2=O)c1 |
| InChI | InChI=1S/C18H17BrN4O2/c1-23(2)10-5-3-4-9(6-10)22-14-8-13(21)15-16(18(14)25)12(20)7-11(19)17(15)24/h3-8,24H,20-21H2,1-2H3/b22-14+ |
| InChIKey | VIKUVQPUUSQGQQ-HYARGMPZSA-N |
| XLogP | 3.07 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|