C19H18Br2N3O2+ — CID 135536937
[3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium (PubChem CID 135536937) has the molecular formula C19H18Br2N3O2+ and a molecular weight of 480.18 g/mol. Its IUPAC name is [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium.
| Compound Name | [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 135536937 |
| Molecular Formula | C19H18Br2N3O2+ |
| Molecular Weight | 480.18 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | [3-[(3,7-dibromo-4-hydroxy-5-imino-8-oxonaphthalen-2-yl)amino]phenyl]-trimethylazanium |
| SMILES | [H]/N=C1\C=C(Br)C(=O)c2cc(Nc3cccc([N+](C)(C)C)c3)c(Br)c(O)c21 |
| InChI | InChI=1S/C19H17Br2N3O2/c1-24(2,3)11-6-4-5-10(7-11)23-15-8-12-16(19(26)17(15)21)14(22)9-13(20)18(12)25/h4-9H,1-3H3,(H2-,22,23,26)/p+1 |
| InChIKey | XOYZTBVFCAEHHU-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.18 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|