C11H10BNO7S2 — CID 18729117
CID 18729117 (PubChem CID 18729117) has the molecular formula C11H10BNO7S2 and a molecular weight of 343.15 g/mol.
| Compound Name | CID 18729117 |
|---|---|
| PubChem CID | 18729117 |
| Molecular Formula | C11H10BNO7S2 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | — |
| SMILES | [B]Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)c(C)c(O)c12 |
| InChI | InChI=1S/C11H10BNO7S2/c1-5-9(22(18,19)20)4-6-8(21(15,16)17)3-2-7(13-12)10(6)11(5)14/h2-4,13-14H,1H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | OPSRLXCTYSUQOR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|