C15H19NO7S2 — CID 88684321
5-hydroxy-4-(pentylamino)naphthalene-1,7-disulfonic acid (PubChem CID 88684321) has the molecular formula C15H19NO7S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 5-hydroxy-4-(pentylamino)naphthalene-1,7-disulfonic acid.
| Compound Name | 5-hydroxy-4-(pentylamino)naphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 88684321 |
| Molecular Formula | C15H19NO7S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 5-hydroxy-4-(pentylamino)naphthalene-1,7-disulfonic acid |
| SMILES | CCCCCNc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C15H19NO7S2/c1-2-3-4-7-16-12-5-6-14(25(21,22)23)11-8-10(24(18,19)20)9-13(17)15(11)12/h5-6,8-9,16-17H,2-4,7H2,1H3,(H,18,19,20)(H,21,22,23) |
| InChIKey | KTUWSJLOKZNOQR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|