C12H10ClNO8S2 — CID 88695738
4-[(2-chloroacetyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 88695738) has the molecular formula C12H10ClNO8S2 and a molecular weight of 395.80 g/mol. Its IUPAC name is 4-[(2-chloroacetyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 4-[(2-chloroacetyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 88695738 |
| Molecular Formula | C12H10ClNO8S2 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | 4-[(2-chloroacetyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | O=C(CCl)Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C12H10ClNO8S2/c13-5-11(16)14-8-1-2-10(24(20,21)22)7-3-6(23(17,18)19)4-9(15)12(7)8/h1-4,15H,5H2,(H,14,16)(H,17,18,19)(H,20,21,22) |
| InChIKey | BKBRAHVFJHVNSH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|