C16H19ClN2O10S3 — CID 18431390
4-[3-(2-chloroethylsulfonyl)propylcarbamoylamino]-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 18431390) has the molecular formula C16H19ClN2O10S3 and a molecular weight of 530.99 g/mol. Its IUPAC name is 4-[3-(2-chloroethylsulfonyl)propylcarbamoylamino]-5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 4-[3-(2-chloroethylsulfonyl)propylcarbamoylamino]-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 18431390 |
| Molecular Formula | C16H19ClN2O10S3 |
| Molecular Weight | 530.99 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | 4-[3-(2-chloroethylsulfonyl)propylcarbamoylamino]-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | O=C(NCCCS(=O)(=O)CCCl)Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C16H19ClN2O10S3/c17-4-7-30(22,23)6-1-5-18-16(21)19-12-2-3-14(32(27,28)29)11-8-10(31(24,25)26)9-13(20)15(11)12/h2-3,8-9,20H,1,4-7H2,(H2,18,19,21)(H,24,25,26)(H,27,28,29) |
| InChIKey | AUOOQXQAHIAEMI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 204.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.99 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|