C45H40N10NaO23S6 — CID 6331086
CID 6331086 (PubChem CID 6331086) has the molecular formula C45H40N10NaO23S6 and a molecular weight of 1304.25 g/mol.
| Compound Name | CID 6331086 |
|---|---|
| PubChem CID | 6331086 |
| Molecular Formula | C45H40N10NaO23S6 |
| Molecular Weight | 1304.25 g/mol |
| Exact Mass | 1303.05 |
| IUPAC Name | — |
| SMILES | Cn1cc(NC(=O)Nc2cc(C(=O)Nc3cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)n(C)c3)n(C)c2)cc1C(=O)Nc1cc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)n(C)c1.[Na] |
| InChI | InChI=1S/C45H40N10O23S6.Na/c1-52-17-21(9-33(52)43(58)50-29-5-7-35(81(67,68)69)27-13-25(79(61,62)63)15-37(39(27)29)83(73,74)75)46-41(56)31-11-23(19-54(31)3)48-45(60)49-24-12-32(55(4)20-24)42(57)47-22-10-34(53(2)18-22)44(59)51-30-6-8-36(82(70,71)72)28-14-26(80(64,65)66)16-38(40(28)30)84(76,77)78;/h5-20H,1-4H3,(H,46,56)(H,47,57)(H,50,58)(H,51,59)(H2,48,49,60)(H,61,62,63)(H,64,65,66)(H,67,68,69)(H,70,71,72)(H,73,74,75)(H,76,77,78); |
| InChIKey | MVUNWRSDCDUAKP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 503.47 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1304.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|