C35H26N4NaO21S6 — CID 6330745
CID 6330745 (PubChem CID 6330745) has the molecular formula C35H26N4NaO21S6 and a molecular weight of 1053.99 g/mol.
| Compound Name | CID 6330745 |
|---|---|
| PubChem CID | 6330745 |
| Molecular Formula | C35H26N4NaO21S6 |
| Molecular Weight | 1053.99 g/mol |
| Exact Mass | 1052.93 |
| IUPAC Name | — |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)c1)Nc1cccc(C(=O)Nc2cccc3c(S(=O)(=O)O)c(S(=O)(=O)O)cc(S(=O)(=O)O)c23)c1.[Na] |
| InChI | InChI=1S/C35H26N4O21S6.Na/c40-33(38-24-9-3-8-22-30(24)28(64(52,53)54)16-29(65(55,56)57)32(22)66(58,59)60)17-4-1-6-19(12-17)36-35(42)37-20-7-2-5-18(13-20)34(41)39-25-10-11-26(62(46,47)48)23-14-21(61(43,44)45)15-27(31(23)25)63(49,50)51;/h1-16H,(H,38,40)(H,39,41)(H2,36,37,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60); |
| InChIKey | OEEYRTLBAVTBHN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 425.55 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.99 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|