C16H12N5O7S2+ — CID 136707775
4-[(8-amino-1-hydroxy-3,5-disulfonaphthalen-2-yl)diazenyl]benzenediazonium (PubChem CID 136707775) has the molecular formula C16H12N5O7S2+ and a molecular weight of 450.43 g/mol. Its IUPAC name is 4-[(8-amino-1-hydroxy-3,5-disulfonaphthalen-2-yl)diazenyl]benzenediazonium.
| Compound Name | 4-[(8-amino-1-hydroxy-3,5-disulfonaphthalen-2-yl)diazenyl]benzenediazonium |
|---|---|
| PubChem CID | 136707775 |
| Molecular Formula | C16H12N5O7S2+ |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 4-[(8-amino-1-hydroxy-3,5-disulfonaphthalen-2-yl)diazenyl]benzenediazonium |
| SMILES | N#[N+]c1ccc(/N=N/c2c(S(=O)(=O)O)cc3c(S(=O)(=O)O)ccc(N)c3c2O)cc1 |
| InChI | InChI=1S/C16H11N5O7S2/c17-11-5-6-12(29(23,24)25)10-7-13(30(26,27)28)15(16(22)14(10)11)21-20-9-3-1-8(19-18)2-4-9/h1-7H,(H4-,17,20,22,23,24,25,26,27,28)/p+1 |
| InChIKey | YRPCXSSEXHNRGS-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 207.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|