C16H13N4NaO6S — CID 175238217
sodium;8-amino-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid;hydride (PubChem CID 175238217) has the molecular formula C16H13N4NaO6S and a molecular weight of 412.36 g/mol. Its IUPAC name is sodium;8-amino-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid;hydride.
| Compound Name | sodium;8-amino-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 175238217 |
| Molecular Formula | C16H13N4NaO6S |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | sodium;8-amino-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid;hydride |
| SMILES | Nc1cccc2c(O)c(/N=N/c3ccc([N+](=O)[O-])cc3)c(S(=O)(=O)O)cc12.[H-].[Na+] |
| InChI | InChI=1S/C16H12N4O6S.Na.H/c17-13-3-1-2-11-12(13)8-14(27(24,25)26)15(16(11)21)19-18-9-4-6-10(7-5-9)20(22)23;;/h1-8,21H,17H2,(H,24,25,26);;/q;+1;-1/b19-18+;; |
| InChIKey | WQGKDKPOZKPIAW-BUFQOAPZSA-N |
| XLogP | 0.81 |
| TPSA | 168.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|