C26H24ClN5O7S2 — CID 135714491
5-amino-6-[(2-chloro-4-methyl-6-sulfophenyl)diazenyl]-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid (PubChem CID 135714491) has the molecular formula C26H24ClN5O7S2 and a molecular weight of 618.09 g/mol. Its IUPAC name is 5-amino-6-[(2-chloro-4-methyl-6-sulfophenyl)diazenyl]-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid.
| Compound Name | 5-amino-6-[(2-chloro-4-methyl-6-sulfophenyl)diazenyl]-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135714491 |
| Molecular Formula | C26H24ClN5O7S2 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.08 |
| IUPAC Name | 5-amino-6-[(2-chloro-4-methyl-6-sulfophenyl)diazenyl]-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-7-methylnaphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(C)c(/N=N/c2c(S(=O)(=O)O)cc3cc(C)c(/N=N/c4c(Cl)cc(C)cc4S(=O)(=O)O)c(N)c3c2O)c1 |
| InChI | InChI=1S/C26H24ClN5O7S2/c1-12-5-6-14(3)18(8-12)29-32-25-20(41(37,38)39)11-16-10-15(4)23(22(28)21(16)26(25)33)30-31-24-17(27)7-13(2)9-19(24)40(34,35)36/h5-11,33H,28H2,1-4H3,(H,34,35,36)(H,37,38,39)/b31-30+,32-29+ |
| InChIKey | CDZAIMARHRVFRV-JUVFNHDTSA-N |
| XLogP | 7.34 |
| TPSA | 204.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|