C30H26N8O13S4 — CID 143475767
3,4-diamino-6-[[4-[(E)-2-[4-[(2,4-diaminophenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 143475767) has the molecular formula C30H26N8O13S4 and a molecular weight of 834.85 g/mol. Its IUPAC name is 3,4-diamino-6-[[4-[(E)-2-[4-[(2,4-diaminophenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3,4-diamino-6-[[4-[(E)-2-[4-[(2,4-diaminophenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 143475767 |
| Molecular Formula | C30H26N8O13S4 |
| Molecular Weight | 834.85 g/mol |
| Exact Mass | 834.05 |
| IUPAC Name | 3,4-diamino-6-[[4-[(E)-2-[4-[(2,4-diaminophenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/C=C/c3ccc(/N=N/c4c(S(=O)(=O)O)cc5cc(S(=O)(=O)O)c(N)c(N)c5c4O)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)c(N)c1 |
| InChI | InChI=1S/C30H26N8O13S4/c31-17-5-8-21(20(32)11-17)37-35-18-6-3-14(22(12-18)52(40,41)42)1-2-15-4-7-19(13-23(15)53(43,44)45)36-38-29-25(55(49,50)51)10-16-9-24(54(46,47)48)27(33)28(34)26(16)30(29)39/h1-13,39H,31-34H2,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)/b2-1+,37-35+,38-36+ |
| InChIKey | SXBPPHLVSAHJGG-PEMJMZPSSA-N |
| XLogP | 4.86 |
| TPSA | 391.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|