C12H4Cl4O6S4 — CID 19906756
1,4,6,9-tetrachlorothianthrene-2,8-disulfonic acid (PubChem CID 19906756) has the molecular formula C12H4Cl4O6S4 and a molecular weight of 514.24 g/mol. Its IUPAC name is 1,4,6,9-tetrachlorothianthrene-2,8-disulfonic acid.
| Compound Name | 1,4,6,9-tetrachlorothianthrene-2,8-disulfonic acid |
|---|---|
| PubChem CID | 19906756 |
| Molecular Formula | C12H4Cl4O6S4 |
| Molecular Weight | 514.24 g/mol |
| Exact Mass | 511.76 |
| IUPAC Name | 1,4,6,9-tetrachlorothianthrene-2,8-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Cl)c2c(c1Cl)Sc1c(Cl)c(S(=O)(=O)O)cc(Cl)c1S2 |
| InChI | InChI=1S/C12H4Cl4O6S4/c13-3-1-5(25(17,18)19)7(15)11-9(3)23-10-4(14)2-6(26(20,21)22)8(16)12(10)24-11/h1-2H,(H,17,18,19)(H,20,21,22) |
| InChIKey | GXOUKKVOJHJNIV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.24 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|