C8H6Cl4O3S — CID 88792486
2,4,5-trichloro-3-(2-chloroethyl)benzenesulfonic acid (PubChem CID 88792486) has the molecular formula C8H6Cl4O3S and a molecular weight of 324.01 g/mol. Its IUPAC name is 2,4,5-trichloro-3-(2-chloroethyl)benzenesulfonic acid.
| Compound Name | 2,4,5-trichloro-3-(2-chloroethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88792486 |
| Molecular Formula | C8H6Cl4O3S |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | 2,4,5-trichloro-3-(2-chloroethyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Cl)c(Cl)c(CCCl)c1Cl |
| InChI | InChI=1S/C8H6Cl4O3S/c9-2-1-4-7(11)5(10)3-6(8(4)12)16(13,14)15/h3H,1-2H2,(H,13,14,15) |
| InChIKey | UXDSCGCZVOLVFT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|