C9H11Cl3O4S — CID 88714036
methanesulfonic acid;2-(2,4,6-trichlorophenyl)ethanol (PubChem CID 88714036) has the molecular formula C9H11Cl3O4S and a molecular weight of 321.61 g/mol. Its IUPAC name is methanesulfonic acid;2-(2,4,6-trichlorophenyl)ethanol.
| Compound Name | methanesulfonic acid;2-(2,4,6-trichlorophenyl)ethanol |
|---|---|
| PubChem CID | 88714036 |
| Molecular Formula | C9H11Cl3O4S |
| Molecular Weight | 321.61 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | methanesulfonic acid;2-(2,4,6-trichlorophenyl)ethanol |
| SMILES | CS(=O)(=O)O.OCCc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl3O.CH4O3S/c9-5-3-7(10)6(1-2-12)8(11)4-5;1-5(2,3)4/h3-4,12H,1-2H2;1H3,(H,2,3,4) |
| InChIKey | WKUARMOPBYTDGA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|