C11H14Cl3N — CID 105350377
N-methyl-4-(2,4,6-trichlorophenyl)butan-1-amine (PubChem CID 105350377) has the molecular formula C11H14Cl3N and a molecular weight of 266.60 g/mol. Its IUPAC name is N-methyl-4-(2,4,6-trichlorophenyl)butan-1-amine.
| Compound Name | N-methyl-4-(2,4,6-trichlorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 105350377 |
| Molecular Formula | C11H14Cl3N |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | N-methyl-4-(2,4,6-trichlorophenyl)butan-1-amine |
| SMILES | CNCCCCc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3N/c1-15-5-3-2-4-9-10(13)6-8(12)7-11(9)14/h6-7,15H,2-5H2,1H3 |
| InChIKey | JBFMMRWNCHBRAQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|