C10H10Cl3NO2S — CID 114616458
2,4,6-trichloro-N-(2-methylprop-2-enyl)benzenesulfonamide (PubChem CID 114616458) has the molecular formula C10H10Cl3NO2S and a molecular weight of 314.62 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(2-methylprop-2-enyl)benzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-(2-methylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114616458 |
| Molecular Formula | C10H10Cl3NO2S |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 2,4,6-trichloro-N-(2-methylprop-2-enyl)benzenesulfonamide |
| SMILES | C=C(C)CNS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl3NO2S/c1-6(2)5-14-17(15,16)10-8(12)3-7(11)4-9(10)13/h3-4,14H,1,5H2,2H3 |
| InChIKey | BREYPEBCQBKAGK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|