C13H18Cl3NO3S — CID 103836427
2,4,6-trichloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide (PubChem CID 103836427) has the molecular formula C13H18Cl3NO3S and a molecular weight of 374.72 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103836427 |
| Molecular Formula | C13H18Cl3NO3S |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 2,4,6-trichloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide |
| SMILES | CCCC(CCO)CNS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl3NO3S/c1-2-3-9(4-5-18)8-17-21(19,20)13-11(15)6-10(14)7-12(13)16/h6-7,9,17-18H,2-5,8H2,1H3 |
| InChIKey | UZCWJVLXMVADQI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |